| Nama produk |
4-[4-(oxiran-2-ylmethoxy)phenyl]-1,2,3-thiadiazole |
| MF |
C11H10N2O2S |
| Berat Molekul |
234.2743 |
| InChI |
InChI=1/C11H10N2O2S/c1-3-9(14-5-10-6-15-10)4-2-8(1)11-7-16-13-12-11/h1-4,7,10H,5-6H2 |
| CAS NO |
59834-07-0 |
| Struktur Molekul |
![59834-07-0 4-[4-(oxiran-2-ylmethoxy)phenyl]-1,2,3-thiadiazole](http://images.chemnet.com/suppliers/chembase/137/13750.gif)
|
| Kepadatan |
1.339g/cm3 |
| Titik lebur |
70℃ |
| Titik didih |
405.6°C at 760 mmHg |
| Indeks bias |
1.613 |
| Titik nyala |
199.1°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
